![[ICO]](/icons/blank.gif){kind=icon}
![[DIR]](/icons/back.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
.png){kind=link}
.jpg){kind=link}
.JPG){kind=link}
.JPG){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| content1.jpg | 19-Feb-2014 05:57 | 30K | |
| content3.jpg | 19-Feb-2014 05:57 | 23K | |
| Head Website.png | 06-Sep-2021 11:48 | 16K | |
| 1-OpenRegistration_EventsPost.png | 01-Aug-2021 14:08 | 11K | |
| 9-BankTransfer_EventsPost (1).png | 19-Jul-2021 13:56 | 8.6K | |
| 9-BankTransfer_EventsPost.png | 19-Jul-2021 13:44 | 8.6K | |
| facebook-logo.png | 19-Feb-2014 05:57 | 8.0K | |
| EDF Scholarship Chart 2016 TH.png | 07-Dec-2016 13:26 | 7.5K | |
| LOGO-COUNTER-SERVICE-Thai.gif | 19-Feb-2014 05:57 | 5.8K | |
| S110_EDF2.jpg | 19-Feb-2014 05:57 | 5.6K | |
| S110_EDF1.jpg | 19-Feb-2014 05:57 | 5.4K | |
| S110_EDF5.jpg | 19-Feb-2014 05:57 | 4.8K | |
| 74631231-3143-4696-A770-943AF128DBBD.JPG | 22-Aug-2021 06:53 | 4.8K | |
| AW_Download-form-th-01.gif | 19-Feb-2014 05:57 | 4.7K | |
| S110_EDF3.jpg | 19-Feb-2014 05:57 | 4.6K | |
| S110_EDF6.jpg | 19-Feb-2014 05:57 | 4.5K | |
| S110_EDF4.jpg | 19-Feb-2014 05:57 | 4.4K | |
| Last180Days.gif | 19-Feb-2014 05:57 | 4.1K | |
| PIC(1).jpg | 19-Feb-2014 05:57 | 4.1K | |
| PIC.jpg | 19-Feb-2014 05:57 | 4.1K | |
| image1.JPG | 21-Sep-2015 10:40 | 4.0K | |
| Under the Same Sky 1.jpg | 01-Oct-2015 10:51 | 4.0K | |
| StorageImage-20081228074817-5508.jpg | 19-Feb-2014 05:57 | 3.9K | |
| Under the Same Sky 3.jpg | 01-Oct-2015 10:53 | 3.9K | |
| image1(1).JPG | 21-Sep-2015 10:50 | 3.9K | |
| Pik_003.jpeg | 06-Dec-2019 16:24 | 3.8K | |
| japan.jpg | 19-Feb-2014 05:57 | 3.8K | |
| LOGO COUNTER SERVICE Thai(1).JPG | 19-Feb-2014 05:57 | 3.8K | |
| LOGO COUNTER SERVICE Thai.jpg | 19-Feb-2014 05:57 | 3.8K | |
| Under the Same Sky 2.jpg | 01-Oct-2015 10:52 | 3.8K | |
| Nokia T_Cyber Kid 2017_3.jpg | 30-Mar-2017 16:32 | 3.7K | |
| EDF Disabled Scholarship Project.jpg | 08-Dec-2016 13:30 | 3.7K | |
| one euro for thailand for web.jpg | 19-Feb-2014 05:57 | 3.7K | |
| 1_นที โทเพ็ชร (2).jpg | 12-Oct-2016 11:39 | 3.7K | |
| Fahpratan6.jpg | 10-Jan-2021 20:54 | 3.7K | |
| Under the Same Sky 4.jpg | 01-Oct-2015 10:54 | 3.7K | |
| one euro for thailand banner.jpg | 19-Feb-2014 05:57 | 3.6K | |
| DSCF2707.JPG | 19-Feb-2014 05:57 | 3.6K | |
| youtube_logo_1261487182988.jpg | 19-Feb-2014 05:57 | 3.6K | |
| Disable Student Training.jpg | 08-Dec-2016 14:33 | 3.5K | |
| daorueng std.jpg | 02-Feb-2023 10:54 | 3.5K | |
| AW_Present Campaign 2016_poster.jpg | 23-Nov-2016 10:53 | 3.5K | |
| IMG_6539.jpg | 21-Sep-2015 10:15 | 3.5K | |
| PAT5.jpg | 11-Oct-2016 15:31 | 3.5K | |
| S__22896700.jpg | 29-Jul-2016 09:55 | 3.5K | |
| FB-Promote-1640x1080pix-8-8SpecialDay.jpg | 07-Aug-2021 05:37 | 3.5K | |
| S__22896700(1).jpg | 29-Jul-2016 10:00 | 3.5K | |
| 2010101313_01.jpg | 19-Feb-2014 05:57 | 3.4K | |
| download.jpg | 19-Feb-2014 05:57 | 3.4K | |
| Malee_31_03_53_100x100.jpg | 19-Feb-2014 05:57 | 3.4K | |
| Hotel.jpg | 19-Feb-2014 05:57 | 3.3K | |
| 2010062222_01.jpg | 19-Feb-2014 05:57 | 3.3K | |
| IMG_4360_1_resize.jpg | 06-Nov-2014 09:25 | 3.3K | |
| 2007_05130114.JPG | 19-Feb-2014 05:57 | 3.3K | |
| DSC09425.JPG | 19-Feb-2014 05:57 | 3.2K | |
| PR-PARPA-Color(Final).jpg | 29-Jul-2016 10:33 | 3.2K | |
| 96204.jpg | 08-Apr-2015 11:48 | 3.2K | |
| 2007_05130505.JPG | 19-Feb-2014 05:57 | 3.2K | |
| Picture 230.jpg | 19-Feb-2014 05:57 | 3.2K | |
| Fah1(1).jpg | 19-Feb-2014 05:57 | 3.1K | |
| rikuzentakataJHS for web.jpg | 19-Feb-2014 05:57 | 3.1K | |
| Pik_001.jpeg | 06-Dec-2019 16:25 | 3.1K | |
| Img (2).jpg | 15-Mar-2016 15:38 | 3.1K | |
| prmaterials_preview.jpg | 19-Feb-2014 05:57 | 3.1K | |
| rikuzentakataJHS Banner .jpg | 19-Feb-2014 05:57 | 3.1K | |
| Fah2.jpg | 19-Feb-2014 05:57 | 3.0K | |
| EDF Thai NGO for web.JPG | 19-Feb-2014 05:57 | 3.0K | |
| Fah3.jpg | 19-Feb-2014 05:57 | 3.0K | |
| EDF_newsletter.jpg | 19-Feb-2014 05:57 | 3.0K | |
| EDF Thai NGO Banner .JPG | 19-Feb-2014 05:57 | 3.0K | |
| IMG_4254_1_resize.jpg | 06-Nov-2014 09:24 | 2.9K | |
| Banner-story-of-Kitima.jpeg | 19-Feb-2014 05:57 | 2.9K | |
| Thai Yamaha EDF 2012.JPG | 19-Feb-2014 05:57 | 2.8K | |
| Fah Banner.jpg | 19-Feb-2014 05:57 | 2.8K | |
| Project.gif | 19-Feb-2014 05:57 | 2.8K | |
| Catalog3TH.jpg | 25-Apr-2019 09:04 | 2.7K | |
| volunteer_dr_warat.jpg | 19-Feb-2014 05:57 | 2.6K | |
| dbcc165036203c63d797c28402a9272f.jpg | 14-Oct-2014 11:56 | 2.6K | |
| 11ZX1000J_008LIMRRFA00D_C1.jpg | 19-Feb-2014 05:57 | 2.6K | |
| Banner-story-of-Kajon.jpeg | 19-Feb-2014 05:57 | 2.6K | |
| EDF_Map Eng.jpg | 19-Feb-2014 05:57 | 2.5K | |
| EDF_600x375.jpg | 19-Feb-2014 05:57 | 2.5K | |
| 2016-10_random (1).jpg | 17-Oct-2016 13:52 | 2.5K | |
| 2016-10_random.jpg | 14-Oct-2016 15:26 | 2.5K | |
| donation_box_leaflet.jpg | 19-Feb-2014 05:57 | 2.5K | |
| SpecialEvent.jpg | 19-Feb-2014 05:57 | 2.4K | |
| twitter_logo.jpg | 19-Feb-2014 05:57 | 2.4K | |
| Supported.jpg | 19-Feb-2014 05:57 | 2.4K | |
| donation_box_large.jpg | 19-Feb-2014 05:57 | 2.4K | |
| volunteer_wvarophas.jpg | 19-Feb-2014 05:57 | 2.4K | |
| nutcharin1.jpg | 19-Feb-2014 05:57 | 2.4K | |
| donation_box_small.jpg | 19-Feb-2014 05:57 | 2.4K | |
| About.jpg | 19-Feb-2014 05:57 | 2.4K | |
| Supported(1).jpg | 19-Feb-2014 05:57 | 2.4K | |
| CSR.jpg | 19-Feb-2014 05:57 | 2.3K | |
| Disable.jpg | 19-Feb-2014 05:57 | 2.3K | |
| 4-Disable-th.jpg | 19-Feb-2014 05:57 | 2.2K | |
| Working-Area.jpg | 19-Feb-2014 05:57 | 2.2K | |
| 1-Junior-th.jpg | 19-Feb-2014 05:57 | 2.2K | |
| 5-Project-th.jpg | 19-Feb-2014 05:57 | 2.2K | |
| Project.jpg | 19-Feb-2014 05:57 | 2.1K | |
| Taifah.jpg | 19-Feb-2014 05:57 | 2.1K | |
| volunteer_Chonlatis2.jpg | 19-Feb-2014 05:57 | 2.1K | |
| High.jpg | 19-Feb-2014 05:57 | 2.0K | |
| 2-High-th.jpg | 19-Feb-2014 05:57 | 2.0K | |
| junior-full.jpg | 19-Feb-2014 05:57 | 1.9K | |
| Junior.jpg | 19-Feb-2014 05:57 | 1.9K | |
| 4 Disable.jpg | 19-Feb-2014 05:57 | 1.9K | |
| Emer.jpg | 19-Feb-2014 05:57 | 1.9K | |
| ContactStudent.jpg | 19-Feb-2014 05:57 | 1.9K | |
| 1 Junior.jpg | 19-Feb-2014 05:57 | 1.9K | |
| Project-Enquiry-Button.gif | 19-Feb-2014 05:57 | 1.9K | |
| aboutUs_brief.jpg | 19-Feb-2014 05:57 | 1.9K | |
| 3-Taifah-th.jpg | 19-Feb-2014 05:57 | 1.8K | |
| junior-regular.jpg | 19-Feb-2014 05:57 | 1.7K | |
| 2 High.jpg | 19-Feb-2014 05:57 | 1.7K | |
| 3 Taifah.jpg | 19-Feb-2014 05:57 | 1.5K | |
| new kicks for the kids/ | 24-Jul-2023 15:06 | - | |
| international program/ | 17-Feb-2014 15:19 | - | |
| icon/ | 04-Nov-2022 14:41 | - | |
| feature stories/ | 26-May-2022 15:08 | - | |
| editor_pic/ | 08-Jun-2018 14:23 | - | |
| donation_page/ | 21-Nov-2019 13:50 | - | |
| donate_button/ | 24-Nov-2023 12:29 | - | |
| disablePic/ | 16-Jun-2016 14:45 | - | |
| article 8-2016/ | 12-Sep-2016 16:22 | - | |
| article 7-7/ | 01-Aug-2016 12:05 | - | |
| article/ | 08-Nov-2024 15:03 | - | |
| Where we work/ | 17-Feb-2014 15:19 | - | |
| Washington University organised/ | 07-Sep-2015 16:17 | - | |
| Waiting-list/ | 27-Jun-2024 20:37 | - | |
| Support EDF logo/ | 24-Mar-2017 13:18 | - | |
| Senior Citizens Smiles One day camp/ | 17-Feb-2014 15:19 | - | |
| STAFF_PIC/ | 21-Mar-2016 15:06 | - | |
| Present/ | 17-Aug-2023 23:29 | - | |
| OUR_WORK/ | 17-Feb-2014 15:19 | - | |
| News pic 2017/ | 31-Mar-2017 14:19 | - | |
| Limited Red Finisher/ | 02-Sep-2021 09:59 | - | |
| JP Pic 2016/ | 28-Nov-2016 11:11 | - | |
| How you Can Help/ | 07-Nov-2022 13:39 | - | |
| Financial report/ | 30-Oct-2024 11:51 | - | |
| EDF Pic 2017/ | 16-Nov-2017 10:31 | - | |
| EDF News Photo 2015/ | 14-Dec-2016 16:13 | - | |
| Donor voices/ | 17-Feb-2014 15:19 | - | |
| Document 2016/ | 16-Jun-2016 14:46 | - | |
| David_news/ | 13-Jun-2016 16:20 | - | |
| About EDF/ | 25-Apr-2024 04:32 | - | |
| 2024-11/ | 01-Nov-2024 15:49 | - | |
| 2024-10/ | 15-Oct-2024 14:59 | - | |
| 2024-08/ | 30-Aug-2024 09:43 | - | |
| 2024-04/ | 09-Apr-2024 10:51 | - | |
| 2024-02/ | 09-Feb-2024 15:51 | - | |
| 2023-11/ | 17-Nov-2023 09:06 | - | |
| 2023-09/ | 06-Nov-2023 11:49 | - | |
| 2023-06/ | 01-Jun-2023 06:29 | - | |
| 2023-03/ | 03-Mar-2023 13:19 | - | |
| 2023-02/ | 10-Feb-2023 15:08 | - | |
| 2023-01/ | 06-Feb-2023 10:15 | - | |
| 2022-12/ | 09-Dec-2022 11:39 | - | |
| 2022-11/ | 04-Nov-2022 15:01 | - | |
| 2022-09/ | 01-Sep-2022 11:51 | - | |
| 2022-07/ | 19-Jul-2022 23:29 | - | |
| 2021 Story/ | 12-Oct-2021 16:47 | - | |
| 2021 Childrityrun/ | 25-Sep-2021 19:51 | - | |
| 2020/ | 15-Dec-2020 09:15 | - | |
| 2019/ | 14-Jul-2023 15:02 | - | |
| 2018/ | 21-Dec-2018 12:02 | - | |
| 25th_pic/ | 15-Oct-2024 14:31 | - | |
| #19 Project/ | 21-Aug-2024 13:34 | - | |
| ฺBOD2019/ | 27-Feb-2019 16:25 | - | |
| มื้อเที่ยงอิ่มใจ/ | 02-Oct-2023 15:55 | - | |